C17H27N3O2 — CID 95740924
1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)propan-1-one (PubChem CID 95740924) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)propan-1-one.
| Compound Name | 1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 95740924 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)propan-1-one |
| SMILES | C=CCn1nc(C)c(CCC(=O)N2C[C@@H](C)O[C@@H](C)C2)c1C |
| InChI | InChI=1S/C17H27N3O2/c1-6-9-20-15(5)16(14(4)18-20)7-8-17(21)19-10-12(2)22-13(3)11-19/h6,12-13H,1,7-11H2,2-5H3/t12-,13+ |
| InChIKey | YAVQFMLHEMFTQV-BETUJISGSA-N |
| XLogP | 2.25 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|