C13H20N2O2 — CID 95740949
N-[(3R)-3-hydroxy-4,4-dimethylpentyl]pyridine-4-carboxamide (PubChem CID 95740949) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is N-[(3R)-3-hydroxy-4,4-dimethylpentyl]pyridine-4-carboxamide.
| Compound Name | N-[(3R)-3-hydroxy-4,4-dimethylpentyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 95740949 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | N-[(3R)-3-hydroxy-4,4-dimethylpentyl]pyridine-4-carboxamide |
| SMILES | CC(C)(C)[C@H](O)CCNC(=O)c1ccncc1 |
| InChI | InChI=1S/C13H20N2O2/c1-13(2,3)11(16)6-9-15-12(17)10-4-7-14-8-5-10/h4-5,7-8,11,16H,6,9H2,1-3H3,(H,15,17)/t11-/m1/s1 |
| InChIKey | FOIUDYHJERJECW-LLVKDONJSA-N |
| XLogP | 1.61 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |