C18H25N3O2 — CID 95741014
N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-4-(pyrazol-1-ylmethyl)benzamide (PubChem CID 95741014) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-4-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-4-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 95741014 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-4-(pyrazol-1-ylmethyl)benzamide |
| SMILES | CC(C)(C)[C@@H](O)CCNC(=O)c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C18H25N3O2/c1-18(2,3)16(22)9-11-19-17(23)15-7-5-14(6-8-15)13-21-12-4-10-20-21/h4-8,10,12,16,22H,9,11,13H2,1-3H3,(H,19,23)/t16-/m0/s1 |
| InChIKey | IDVBGUFVKBGJCE-INIZCTEOSA-N |
| XLogP | 2.46 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |