C21H18N2O3 — CID 95744990
N-(7-methoxyquinolin-3-yl)-3,5-dimethyl-1-benzofuran-2-carboxamide (PubChem CID 95744990) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(7-methoxyquinolin-3-yl)-3,5-dimethyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(7-methoxyquinolin-3-yl)-3,5-dimethyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 95744990 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N-(7-methoxyquinolin-3-yl)-3,5-dimethyl-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2cc(NC(=O)c3oc4ccc(C)cc4c3C)cnc2c1 |
| InChI | InChI=1S/C21H18N2O3/c1-12-4-7-19-17(8-12)13(2)20(26-19)21(24)23-15-9-14-5-6-16(25-3)10-18(14)22-11-15/h4-11H,1-3H3,(H,23,24) |
| InChIKey | IOUTWNFZTIEKOO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |