C19H21N2O7P — CID 9574778
1-[(2R,5S)-5-[[(2R)-6,8-dimethyl-2-oxo-4H-1,3,2$l^{5}-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-methyl-pyrimidine-2,4-dione (PubChem CID 9574778) has the molecular formula C19H21N2O7P and a molecular weight of 420.40 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[[(2R)-6,8-dimethyl-2-oxo-4H-1,3,2lambda5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-[[(2R)-6,8-dimethyl-2-oxo-4H-1,3,2$l^{5}-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-methyl-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 9574778 |
| Molecular Formula | C19H21N2O7P |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 1-[(2R,5S)-5-[[(2R)-6,8-dimethyl-2-oxo-4H-1,3,2lambda5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CC1=CC(=C2C(=C1)CO[P@@](=O)(O2)OC[C@@H]3C=C[C@@H](O3)N4C=C(C(=O)NC4=O)C)C |
| InChI | InChI=1S/C19H21N2O7P/c1-11-6-12(2)17-14(7-11)9-25-29(24,28-17)26-10-15-4-5-16(27-15)21-8-13(3)18(22)20-19(21)23/h4-8,15-16H,9-10H2,1-3H3,(H,20,22,23)/t15-,16+,29+/m0/s1 |
| InChIKey | JYKKHTPNZTYTKR-PWEULYCESA-N |
| XLogP | 1.20 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | 797 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|