C15H18N4O2S — CID 95747977
N,N,1,5-tetramethyl-4-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]pyrazole-3-carboxamide (PubChem CID 95747977) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is N,N,1,5-tetramethyl-4-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]pyrazole-3-carboxamide.
| Compound Name | N,N,1,5-tetramethyl-4-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 95747977 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N,N,1,5-tetramethyl-4-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]pyrazole-3-carboxamide |
| SMILES | Cc1c(NC(=O)/C=C/c2cccs2)c(C(=O)N(C)C)nn1C |
| InChI | InChI=1S/C15H18N4O2S/c1-10-13(14(17-19(10)4)15(21)18(2)3)16-12(20)8-7-11-6-5-9-22-11/h5-9H,1-4H3,(H,16,20)/b8-7+ |
| InChIKey | QWGNRENTMPWDMP-BQYQJAHWSA-N |
| XLogP | 2.14 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|