C15H14N4OS — CID 18151319
(E)-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 18151319) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is (E)-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 18151319 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (E)-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | Cc1nn(C)c2ncc(NC(=O)/C=C/c3cccs3)cc12 |
| InChI | InChI=1S/C15H14N4OS/c1-10-13-8-11(9-16-15(13)19(2)18-10)17-14(20)6-5-12-4-3-7-21-12/h3-9H,1-2H3,(H,17,20)/b6-5+ |
| InChIKey | UDRBCURLTATMKC-AATRIKPKSA-N |
| XLogP | 2.99 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|