C23H27N5O3S — CID 55515473
(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)prop-2-enamide (PubChem CID 55515473) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55515473 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)prop-2-enamide |
| SMILES | Cc1nn(C)c2ncc(NC(=O)/C=C/c3ccc(S(=O)(=O)N4CCCCCC4)cc3)cc12 |
| InChI | InChI=1S/C23H27N5O3S/c1-17-21-15-19(16-24-23(21)27(2)26-17)25-22(29)12-9-18-7-10-20(11-8-18)32(30,31)28-13-5-3-4-6-14-28/h7-12,15-16H,3-6,13-14H2,1-2H3,(H,25,29)/b12-9+ |
| InChIKey | MJPFMHGMEYHYDN-FMIVXFBMSA-N |
| XLogP | 3.49 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|