C24H27N5O5S — CID 55456862
(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)prop-2-enamide (PubChem CID 55456862) has the molecular formula C24H27N5O5S and a molecular weight of 497.58 g/mol. Its IUPAC name is (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55456862 |
| Molecular Formula | C24H27N5O5S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)prop-2-enamide |
| SMILES | Cn1c(=O)c2cc(NC(=O)/C=C/c3ccc(S(=O)(=O)N4CCCCCC4)cc3)cnc2n(C)c1=O |
| InChI | InChI=1S/C24H27N5O5S/c1-27-22-20(23(31)28(2)24(27)32)15-18(16-25-22)26-21(30)12-9-17-7-10-19(11-8-17)35(33,34)29-13-5-3-4-6-14-29/h7-12,15-16H,3-6,13-14H2,1-2H3,(H,26,30)/b12-9+ |
| InChIKey | MISGPCMLZIBLCP-FMIVXFBMSA-N |
| XLogP | 1.85 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|