C14H16N4O — CID 47148686
(2E,4E)-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)hexa-2,4-dienamide (PubChem CID 47148686) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is (2E,4E)-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 47148686 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (2E,4E)-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1cnc2c(c1)c(C)nn2C |
| InChI | InChI=1S/C14H16N4O/c1-4-5-6-7-13(19)16-11-8-12-10(2)17-18(3)14(12)15-9-11/h4-9H,1-3H3,(H,16,19)/b5-4+,7-6+ |
| InChIKey | DFQNBYKJRGCSBV-YTXTXJHMSA-N |
| XLogP | 2.35 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|