C15H23BrN4O — CID 95749759
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-prop-2-enyl-1,4-diazepan-1-yl)ethanone (PubChem CID 95749759) has the molecular formula C15H23BrN4O and a molecular weight of 355.28 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-prop-2-enyl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-prop-2-enyl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 95749759 |
| Molecular Formula | C15H23BrN4O |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-prop-2-enyl-1,4-diazepan-1-yl)ethanone |
| SMILES | C=CCN1CCCN(C(=O)Cn2nc(C)c(Br)c2C)CC1 |
| InChI | InChI=1S/C15H23BrN4O/c1-4-6-18-7-5-8-19(10-9-18)14(21)11-20-13(3)15(16)12(2)17-20/h4H,1,5-11H2,2-3H3 |
| InChIKey | UTYVWHSPQFJIQS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|