C19H26N4O — CID 95750345
N-methyl-2-[2-(4-methylpyrazol-1-yl)ethylamino]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 95750345) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is N-methyl-2-[2-(4-methylpyrazol-1-yl)ethylamino]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | N-methyl-2-[2-(4-methylpyrazol-1-yl)ethylamino]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 95750345 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | N-methyl-2-[2-(4-methylpyrazol-1-yl)ethylamino]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | Cc1cnn(CCNCC(=O)N(C)[C@H]2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C19H26N4O/c1-15-12-21-23(14-15)11-10-20-13-19(24)22(2)18-9-5-7-16-6-3-4-8-17(16)18/h3-4,6,8,12,14,18,20H,5,7,9-11,13H2,1-2H3/t18-/m0/s1 |
| InChIKey | SGEOMFIIPZKDOZ-SFHVURJKSA-N |
| XLogP | 2.32 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|