C19H21NO — CID 134791703
N,2-dimethyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide (PubChem CID 134791703) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is N,2-dimethyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide.
| Compound Name | N,2-dimethyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide |
|---|---|
| PubChem CID | 134791703 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N,2-dimethyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide |
| SMILES | Cc1ccccc1C(=O)N(C)C1CCCc2ccccc21 |
| InChI | InChI=1S/C19H21NO/c1-14-8-3-5-11-16(14)19(21)20(2)18-13-7-10-15-9-4-6-12-17(15)18/h3-6,8-9,11-12,18H,7,10,13H2,1-2H3 |
| InChIKey | LZQMXKJOTRKIFD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |