C20H20N4O — CID 97131739
N-methyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 97131739) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is N-methyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | N-methyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 97131739 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-methyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | CN(C(=O)c1ccccc1-c1ncn[nH]1)[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C20H20N4O/c1-24(18-12-6-8-14-7-2-3-9-15(14)18)20(25)17-11-5-4-10-16(17)19-21-13-22-23-19/h2-5,7,9-11,13,18H,6,8,12H2,1H3,(H,21,22,23)/t18-/m0/s1 |
| InChIKey | HJJYVRJILDJNJK-SFHVURJKSA-N |
| XLogP | 3.62 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |