C20H22N4O — CID 37153510
N,5,7-trimethyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 37153510) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is N,5,7-trimethyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N,5,7-trimethyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 37153510 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N,5,7-trimethyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1cc(C)n2ncc(C(=O)N(C)[C@@H]3CCCc4ccccc43)c2n1 |
| InChI | InChI=1S/C20H22N4O/c1-13-11-14(2)24-19(22-13)17(12-21-24)20(25)23(3)18-10-6-8-15-7-4-5-9-16(15)18/h4-5,7,9,11-12,18H,6,8,10H2,1-3H3/t18-/m1/s1 |
| InChIKey | CCKYCDIDPGJTCQ-GOSISDBHSA-N |
| XLogP | 3.50 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |