C20H25N3O — CID 96576738
N,2-dimethyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 96576738) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is N,2-dimethyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | N,2-dimethyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 96576738 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N,2-dimethyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CN(C(=O)c1c2c(nn1C)CCCC2)[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C20H25N3O/c1-22(18-13-7-9-14-8-3-4-10-15(14)18)20(24)19-16-11-5-6-12-17(16)21-23(19)2/h3-4,8,10,18H,5-7,9,11-13H2,1-2H3/t18-/m0/s1 |
| InChIKey | AMJVOUQQVFWRIV-SFHVURJKSA-N |
| XLogP | 3.45 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |