C12H24N2O2S — CID 95751499
1-(cyclopropylmethyl)-4-propan-2-ylsulfonyl-1,4-diazepane (PubChem CID 95751499) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-propan-2-ylsulfonyl-1,4-diazepane.
| Compound Name | 1-(cyclopropylmethyl)-4-propan-2-ylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 95751499 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-propan-2-ylsulfonyl-1,4-diazepane |
| SMILES | CC(C)S(=O)(=O)N1CCCN(CC2CC2)CC1 |
| InChI | InChI=1S/C12H24N2O2S/c1-11(2)17(15,16)14-7-3-6-13(8-9-14)10-12-4-5-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | VLNJOBYBECRHEE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |