C17H23N3O2 — CID 95753651
N-(3,3-dimethyl-2-oxobutyl)-3-(4-methylindazol-1-yl)propanamide (PubChem CID 95753651) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-(3,3-dimethyl-2-oxobutyl)-3-(4-methylindazol-1-yl)propanamide.
| Compound Name | N-(3,3-dimethyl-2-oxobutyl)-3-(4-methylindazol-1-yl)propanamide |
|---|---|
| PubChem CID | 95753651 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-(3,3-dimethyl-2-oxobutyl)-3-(4-methylindazol-1-yl)propanamide |
| SMILES | Cc1cccc2c1cnn2CCC(=O)NCC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H23N3O2/c1-12-6-5-7-14-13(12)10-19-20(14)9-8-16(22)18-11-15(21)17(2,3)4/h5-7,10H,8-9,11H2,1-4H3,(H,18,22) |
| InChIKey | NVSAGQFDKHMIQL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |