C17H13ClN4O3 — CID 95754701
5-[(2-chlorophenoxy)methyl]-N-[1-(cyanomethyl)pyrazol-3-yl]furan-2-carboxamide (PubChem CID 95754701) has the molecular formula C17H13ClN4O3 and a molecular weight of 356.77 g/mol. Its IUPAC name is 5-[(2-chlorophenoxy)methyl]-N-[1-(cyanomethyl)pyrazol-3-yl]furan-2-carboxamide.
| Compound Name | 5-[(2-chlorophenoxy)methyl]-N-[1-(cyanomethyl)pyrazol-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 95754701 |
| Molecular Formula | C17H13ClN4O3 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 5-[(2-chlorophenoxy)methyl]-N-[1-(cyanomethyl)pyrazol-3-yl]furan-2-carboxamide |
| SMILES | N#CCn1ccc(NC(=O)c2ccc(COc3ccccc3Cl)o2)n1 |
| InChI | InChI=1S/C17H13ClN4O3/c18-13-3-1-2-4-14(13)24-11-12-5-6-15(25-12)17(23)20-16-7-9-22(21-16)10-8-19/h1-7,9H,10-11H2,(H,20,21,23) |
| InChIKey | ZUQOQCZRMUTDKG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |