C5H5F7O3S — CID 95757136
2,2,3,3,4,4,4-heptafluorobutyl methanesulfonate (PubChem CID 95757136) has the molecular formula C5H5F7O3S and a molecular weight of 278.14 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl methanesulfonate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl methanesulfonate |
|---|---|
| PubChem CID | 95757136 |
| Molecular Formula | C5H5F7O3S |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H5F7O3S/c1-16(13,14)15-2-3(6,7)4(8,9)5(10,11)12/h2H2,1H3 |
| InChIKey | BIAQIBMKUAWVNN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|