C19H26FN3O2 — CID 95758277
3-[3-(3-fluoro-N-methylanilino)propyl]-1-[[(2R)-oxolan-2-yl]methyl]-1-prop-2-ynylurea (PubChem CID 95758277) has the molecular formula C19H26FN3O2 and a molecular weight of 347.43 g/mol. Its IUPAC name is 3-[3-(3-fluoro-N-methylanilino)propyl]-1-[[(2R)-oxolan-2-yl]methyl]-1-prop-2-ynylurea.
| Compound Name | 3-[3-(3-fluoro-N-methylanilino)propyl]-1-[[(2R)-oxolan-2-yl]methyl]-1-prop-2-ynylurea |
|---|---|
| PubChem CID | 95758277 |
| Molecular Formula | C19H26FN3O2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 3-[3-(3-fluoro-N-methylanilino)propyl]-1-[[(2R)-oxolan-2-yl]methyl]-1-prop-2-ynylurea |
| SMILES | C#CCN(C[C@H]1CCCO1)C(=O)NCCCN(C)c1cccc(F)c1 |
| InChI | InChI=1S/C19H26FN3O2/c1-3-11-23(15-18-9-5-13-25-18)19(24)21-10-6-12-22(2)17-8-4-7-16(20)14-17/h1,4,7-8,14,18H,5-6,9-13,15H2,2H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | CRMUKLCEROVYAZ-GOSISDBHSA-N |
| XLogP | 2.48 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|