C14H13NO5 — CID 95760144
cis-(3-prop-2-ynoxyphenyl)methyl (1R,2S)-2-nitrocyclopropane-1-carboxylate (PubChem CID 95760144) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is cis-(3-prop-2-ynoxyphenyl)methyl (1R,2S)-2-nitrocyclopropane-1-carboxylate.
| Compound Name | cis-(3-prop-2-ynoxyphenyl)methyl (1R,2S)-2-nitrocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 95760144 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | cis-(3-prop-2-ynoxyphenyl)methyl (1R,2S)-2-nitrocyclopropane-1-carboxylate |
| SMILES | C#CCOc1cccc(COC(=O)[C@@H]2C[C@@H]2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13NO5/c1-2-6-19-11-5-3-4-10(7-11)9-20-14(16)12-8-13(12)15(17)18/h1,3-5,7,12-13H,6,8-9H2/t12-,13+/m1/s1 |
| InChIKey | MWZUDNNDWVVXOP-OLZOCXBDSA-N |
| XLogP | 1.41 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|