C19H25F3N2O3 — CID 95762529
1-(1,3-benzodioxol-5-ylmethyl)-1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 95762529) has the molecular formula C19H25F3N2O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 95762529 |
| Molecular Formula | C19H25F3N2O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1N(Cc1ccc2c(c1)OCO2)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C19H25F3N2O3/c1-12-4-3-5-15(13(12)2)24(18(25)23-10-19(20,21)22)9-14-6-7-16-17(8-14)27-11-26-16/h6-8,12-13,15H,3-5,9-11H2,1-2H3,(H,23,25)/t12-,13-,15-/m1/s1 |
| InChIKey | KNDRNQFIUVVBLP-UMVBOHGHSA-N |
| XLogP | 4.31 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |