C25H28ClN3O5 — CID 98772132
1-(1,3-benzodioxol-5-ylmethyl)-3-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-1-[(1R,2S,3R)-2,3-dimethylcyclohexyl]urea (PubChem CID 98772132) has the molecular formula C25H28ClN3O5 and a molecular weight of 485.97 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-1-[(1R,2S,3R)-2,3-dimethylcyclohexyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-1-[(1R,2S,3R)-2,3-dimethylcyclohexyl]urea |
|---|---|
| PubChem CID | 98772132 |
| Molecular Formula | C25H28ClN3O5 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-1-[(1R,2S,3R)-2,3-dimethylcyclohexyl]urea |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1N(Cc1ccc2c(c1)OCO2)C(=O)Nc1cc2c(cc1Cl)NC(=O)CO2 |
| InChI | InChI=1S/C25H28ClN3O5/c1-14-4-3-5-20(15(14)2)29(11-16-6-7-21-23(8-16)34-13-33-21)25(31)28-18-10-22-19(9-17(18)26)27-24(30)12-32-22/h6-10,14-15,20H,3-5,11-13H2,1-2H3,(H,27,30)(H,28,31)/t14-,15+,20-/m1/s1 |
| InChIKey | KFQMHCGSFGHVOD-QEEYODRMSA-N |
| XLogP | 5.26 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |