C17H19N3O3 — CID 95762546
1-(furan-2-ylmethyl)-3-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]urea (PubChem CID 95762546) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]urea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 95762546 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]urea |
| SMILES | O=C(NCc1ccco1)N[C@H](CO)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H19N3O3/c21-11-13(20-17(22)19-10-14-4-3-7-23-14)8-12-9-18-16-6-2-1-5-15(12)16/h1-7,9,13,18,21H,8,10-11H2,(H2,19,20,22)/t13-/m0/s1 |
| InChIKey | OMWPDWRLOFGKIU-ZDUSSCGKSA-N |
| XLogP | 2.16 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |