C13H14F3N3O — CID 95767491
(1S)-N-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-1-(3,4,5-trifluorophenyl)ethanamine (PubChem CID 95767491) has the molecular formula C13H14F3N3O and a molecular weight of 285.27 g/mol. Its IUPAC name is (1S)-N-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-1-(3,4,5-trifluorophenyl)ethanamine.
| Compound Name | (1S)-N-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-1-(3,4,5-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 95767491 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (1S)-N-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-1-(3,4,5-trifluorophenyl)ethanamine |
| SMILES | Cc1nnc([C@H](C)N[C@@H](C)c2cc(F)c(F)c(F)c2)o1 |
| InChI | InChI=1S/C13H14F3N3O/c1-6(9-4-10(14)12(16)11(15)5-9)17-7(2)13-19-18-8(3)20-13/h4-7,17H,1-3H3/t6-,7-/m0/s1 |
| InChIKey | RLUAXFHIJJGECH-BQBZGAKWSA-N |
| XLogP | 3.21 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|