C16H20FN3O2S — CID 95769870
(2R)-N-(2-fluorophenyl)-2-(thiomorpholine-4-carbonyl)pyrrolidine-1-carboxamide (PubChem CID 95769870) has the molecular formula C16H20FN3O2S and a molecular weight of 337.42 g/mol. Its IUPAC name is (2R)-N-(2-fluorophenyl)-2-(thiomorpholine-4-carbonyl)pyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-(2-fluorophenyl)-2-(thiomorpholine-4-carbonyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 95769870 |
| Molecular Formula | C16H20FN3O2S |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (2R)-N-(2-fluorophenyl)-2-(thiomorpholine-4-carbonyl)pyrrolidine-1-carboxamide |
| SMILES | O=C([C@H]1CCCN1C(=O)Nc1ccccc1F)N1CCSCC1 |
| InChI | InChI=1S/C16H20FN3O2S/c17-12-4-1-2-5-13(12)18-16(22)20-7-3-6-14(20)15(21)19-8-10-23-11-9-19/h1-2,4-5,14H,3,6-11H2,(H,18,22)/t14-/m1/s1 |
| InChIKey | BQKWJCGOBSAMHA-CQSZACIVSA-N |
| XLogP | 2.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |