C21H22N2OS — CID 95772810
N-[(1S)-1-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]propyl]benzamide (PubChem CID 95772810) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is N-[(1S)-1-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]propyl]benzamide.
| Compound Name | N-[(1S)-1-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 95772810 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-[(1S)-1-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]propyl]benzamide |
| SMILES | CC[C@H](NC(=O)c1ccccc1)c1nc(-c2cc(C)ccc2C)cs1 |
| InChI | InChI=1S/C21H22N2OS/c1-4-18(22-20(24)16-8-6-5-7-9-16)21-23-19(13-25-21)17-12-14(2)10-11-15(17)3/h5-13,18H,4H2,1-3H3,(H,22,24)/t18-/m0/s1 |
| InChIKey | FAEWESHCLRHUKG-SFHVURJKSA-N |
| XLogP | 5.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |