C21H23NO3 — CID 957730
(3R)-3-hydroxy-1-methyl-3-[2-(2-methyl-5-propan-2-ylphenyl)-2-oxoethyl]indol-2-one (PubChem CID 957730) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-methyl-3-[2-(2-methyl-5-propan-2-ylphenyl)-2-oxoethyl]indol-2-one.
| Compound Name | (3R)-3-hydroxy-1-methyl-3-[2-(2-methyl-5-propan-2-ylphenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 957730 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (3R)-3-hydroxy-1-methyl-3-[2-(2-methyl-5-propan-2-ylphenyl)-2-oxoethyl]indol-2-one |
| SMILES | Cc1ccc(C(C)C)cc1C(=O)C[C@]1(O)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C21H23NO3/c1-13(2)15-10-9-14(3)16(11-15)19(23)12-21(25)17-7-5-6-8-18(17)22(4)20(21)24/h5-11,13,25H,12H2,1-4H3/t21-/m1/s1 |
| InChIKey | ZRRFSBBGPRHVNK-OAQYLSRUSA-N |
| XLogP | 3.56 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |