C17H30N4OS — CID 95773931
(2S)-2-butylsulfanyl-1-[(2R)-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]pyrrolidin-1-yl]propan-1-one (PubChem CID 95773931) has the molecular formula C17H30N4OS and a molecular weight of 338.52 g/mol. Its IUPAC name is (2S)-2-butylsulfanyl-1-[(2R)-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]pyrrolidin-1-yl]propan-1-one.
| Compound Name | (2S)-2-butylsulfanyl-1-[(2R)-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 95773931 |
| Molecular Formula | C17H30N4OS |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (2S)-2-butylsulfanyl-1-[(2R)-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]pyrrolidin-1-yl]propan-1-one |
| SMILES | CCCCS[C@@H](C)C(=O)N1CCC[C@@H]1c1nncn1CC(C)C |
| InChI | InChI=1S/C17H30N4OS/c1-5-6-10-23-14(4)17(22)21-9-7-8-15(21)16-19-18-12-20(16)11-13(2)3/h12-15H,5-11H2,1-4H3/t14-,15+/m0/s1 |
| InChIKey | BHYGQIPCCLMFRC-LSDHHAIUSA-N |
| XLogP | 3.52 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|