C22H33FN4O — CID 95774073
2-[[(S)-(3-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]-methylamino]-N-[(2S)-octan-2-yl]acetamide (PubChem CID 95774073) has the molecular formula C22H33FN4O and a molecular weight of 388.53 g/mol. Its IUPAC name is 2-[[(S)-(3-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]-methylamino]-N-[(2S)-octan-2-yl]acetamide.
| Compound Name | 2-[[(S)-(3-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]-methylamino]-N-[(2S)-octan-2-yl]acetamide |
|---|---|
| PubChem CID | 95774073 |
| Molecular Formula | C22H33FN4O |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2-[[(S)-(3-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]-methylamino]-N-[(2S)-octan-2-yl]acetamide |
| SMILES | CCCCCC[C@H](C)NC(=O)CN(C)[C@@H](c1cccc(F)c1)c1cnn(C)c1 |
| InChI | InChI=1S/C22H33FN4O/c1-5-6-7-8-10-17(2)25-21(28)16-26(3)22(19-14-24-27(4)15-19)18-11-9-12-20(23)13-18/h9,11-15,17,22H,5-8,10,16H2,1-4H3,(H,25,28)/t17-,22-/m0/s1 |
| InChIKey | DWVRLAVPELXJOQ-JTSKRJEESA-N |
| XLogP | 4.06 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|