About 1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea
1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea (PubChem CID 95774153) has the molecular formula C16H27N5O2
and a molecular weight of 321.43 g/mol. Its IUPAC name is 1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea.
Molecular Properties
| Compound Name | 1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea |
| PubChem CID | 95774153 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea |
| SMILES | CN1C[C@@H](NC(=O)Nc2cc(CC(C)(C)C)nn2C)CCC1=O |
| InChI | InChI=1S/C16H27N5O2/c1-16(2,3)9-12-8-13(21(5)19-12)18-15(23)17-11-6-7-14(22)20(4)10-11/h8,11H,6-7,9-10H2,1-5H3,(H2,17,18,23)/t11-/m0/s1 |
| InChIKey | JMBNXNLOJUWGNY-NSHDSACASA-N |
| XLogP | 1.75 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea?
The IUPAC name of 1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea (CID 95774153) is 1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea.
What is the SMILES notation for 1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea?
The canonical SMILES for 1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea is CN1C[C@@H](NC(=O)Nc2cc(CC(C)(C)C)nn2C)CCC1=O.
What is the InChIKey of 1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea?
The InChIKey is JMBNXNLOJUWGNY-NSHDSACASA-N. The full InChI is InChI=1S/C16H27N5O2/c1-16(2,3)9-12-8-13(21(5)19-12)18-15(23)17-11-6-7-14(22)20(4)10-11/h8,11H,6-7,9-10H2,1-5H3,(H2,17,18,23)/t11-/m0/s1.
What are the key properties of 1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea?
1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea has a molecular weight of 321.43 g/mol, XLogP of 1.75, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]urea is sourced from PubChem (CID 95774153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).