C19H19NO4S — CID 95776307
N-[(3-methoxyphenyl)methyl]-3-[[(S)-methylsulfinyl]methyl]-1-benzofuran-2-carboxamide (PubChem CID 95776307) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-3-[[(S)-methylsulfinyl]methyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-3-[[(S)-methylsulfinyl]methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 95776307 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-3-[[(S)-methylsulfinyl]methyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2oc3ccccc3c2C[S@](C)=O)c1 |
| InChI | InChI=1S/C19H19NO4S/c1-23-14-7-5-6-13(10-14)11-20-19(21)18-16(12-25(2)22)15-8-3-4-9-17(15)24-18/h3-10H,11-12H2,1-2H3,(H,20,21)/t25-/m0/s1 |
| InChIKey | AUTCDAPASFURNU-VWLOTQADSA-N |
| XLogP | 3.25 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |