C21H17N3O4S — CID 95776341
3-[[(R)-methylsulfinyl]methyl]-N-(4-pyrimidin-2-yloxyphenyl)-1-benzofuran-2-carboxamide (PubChem CID 95776341) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is 3-[[(R)-methylsulfinyl]methyl]-N-(4-pyrimidin-2-yloxyphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-[[(R)-methylsulfinyl]methyl]-N-(4-pyrimidin-2-yloxyphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 95776341 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 3-[[(R)-methylsulfinyl]methyl]-N-(4-pyrimidin-2-yloxyphenyl)-1-benzofuran-2-carboxamide |
| SMILES | C[S@@](=O)Cc1c(C(=O)Nc2ccc(Oc3ncccn3)cc2)oc2ccccc12 |
| InChI | InChI=1S/C21H17N3O4S/c1-29(26)13-17-16-5-2-3-6-18(16)28-19(17)20(25)24-14-7-9-15(10-8-14)27-21-22-11-4-12-23-21/h2-12H,13H2,1H3,(H,24,25)/t29-/m1/s1 |
| InChIKey | GCANVYPIDCKHDP-GDLZYMKVSA-N |
| XLogP | 4.15 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |