C19H16F3NO4 — CID 7957155
3-(ethoxymethyl)-N-[4-(trifluoromethoxy)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 7957155) has the molecular formula C19H16F3NO4 and a molecular weight of 379.33 g/mol. Its IUPAC name is 3-(ethoxymethyl)-N-[4-(trifluoromethoxy)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3-(ethoxymethyl)-N-[4-(trifluoromethoxy)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7957155 |
| Molecular Formula | C19H16F3NO4 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 3-(ethoxymethyl)-N-[4-(trifluoromethoxy)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | CCOCc1c(C(=O)Nc2ccc(OC(F)(F)F)cc2)oc2ccccc12 |
| InChI | InChI=1S/C19H16F3NO4/c1-2-25-11-15-14-5-3-4-6-16(14)26-17(15)18(24)23-12-7-9-13(10-8-12)27-19(20,21)22/h3-10H,2,11H2,1H3,(H,23,24) |
| InChIKey | HYEHPAUHHMPAJH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |