C16H30N2O5S — CID 95776489
(3S)-1-(2,2-dimethylpropanoyl)-N-[2-(2-methylsulfonylethoxy)ethyl]piperidine-3-carboxamide (PubChem CID 95776489) has the molecular formula C16H30N2O5S and a molecular weight of 362.49 g/mol. Its IUPAC name is (3S)-1-(2,2-dimethylpropanoyl)-N-[2-(2-methylsulfonylethoxy)ethyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(2,2-dimethylpropanoyl)-N-[2-(2-methylsulfonylethoxy)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95776489 |
| Molecular Formula | C16H30N2O5S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (3S)-1-(2,2-dimethylpropanoyl)-N-[2-(2-methylsulfonylethoxy)ethyl]piperidine-3-carboxamide |
| SMILES | CC(C)(C)C(=O)N1CCC[C@H](C(=O)NCCOCCS(C)(=O)=O)C1 |
| InChI | InChI=1S/C16H30N2O5S/c1-16(2,3)15(20)18-8-5-6-13(12-18)14(19)17-7-9-23-10-11-24(4,21)22/h13H,5-12H2,1-4H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | OZYMEGIFBFHDMT-ZDUSSCGKSA-N |
| XLogP | 0.45 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|