C19H25FN2O2 — CID 95777428
4-(3-fluorophenoxy)-N-[(2S)-4-(1-methylpyrrol-2-yl)butan-2-yl]butanamide (PubChem CID 95777428) has the molecular formula C19H25FN2O2 and a molecular weight of 332.42 g/mol. Its IUPAC name is 4-(3-fluorophenoxy)-N-[(2S)-4-(1-methylpyrrol-2-yl)butan-2-yl]butanamide.
| Compound Name | 4-(3-fluorophenoxy)-N-[(2S)-4-(1-methylpyrrol-2-yl)butan-2-yl]butanamide |
|---|---|
| PubChem CID | 95777428 |
| Molecular Formula | C19H25FN2O2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 4-(3-fluorophenoxy)-N-[(2S)-4-(1-methylpyrrol-2-yl)butan-2-yl]butanamide |
| SMILES | C[C@@H](CCc1cccn1C)NC(=O)CCCOc1cccc(F)c1 |
| InChI | InChI=1S/C19H25FN2O2/c1-15(10-11-17-7-4-12-22(17)2)21-19(23)9-5-13-24-18-8-3-6-16(20)14-18/h3-4,6-8,12,14-15H,5,9-11,13H2,1-2H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | FVXUFSFGGGHQTK-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|