C14H16N6O3 — CID 95777987
methyl (3S)-3-[[4-(tetrazol-1-yl)benzoyl]amino]pyrrolidine-1-carboxylate (PubChem CID 95777987) has the molecular formula C14H16N6O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is methyl (3S)-3-[[4-(tetrazol-1-yl)benzoyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | methyl (3S)-3-[[4-(tetrazol-1-yl)benzoyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 95777987 |
| Molecular Formula | C14H16N6O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | methyl (3S)-3-[[4-(tetrazol-1-yl)benzoyl]amino]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CC[C@H](NC(=O)c2ccc(-n3cnnn3)cc2)C1 |
| InChI | InChI=1S/C14H16N6O3/c1-23-14(22)19-7-6-11(8-19)16-13(21)10-2-4-12(5-3-10)20-9-15-17-18-20/h2-5,9,11H,6-8H2,1H3,(H,16,21)/t11-/m0/s1 |
| InChIKey | KHRWAXWGSPOVAT-NSHDSACASA-N |
| XLogP | 0.23 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |