C17H22N4O4 — CID 95779392
[(2S)-2-(5-ethyl-1,2,4-oxadiazol-3-yl)pyrrolidin-1-yl]-[6-(2-methoxyethoxy)-3-pyridinyl]methanone (PubChem CID 95779392) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is [(2S)-2-(5-ethyl-1,2,4-oxadiazol-3-yl)pyrrolidin-1-yl]-[6-(2-methoxyethoxy)-3-pyridinyl]methanone.
| Compound Name | [(2S)-2-(5-ethyl-1,2,4-oxadiazol-3-yl)pyrrolidin-1-yl]-[6-(2-methoxyethoxy)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 95779392 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | [(2S)-2-(5-ethyl-1,2,4-oxadiazol-3-yl)pyrrolidin-1-yl]-[6-(2-methoxyethoxy)-3-pyridinyl]methanone |
| SMILES | CCc1nc([C@@H]2CCCN2C(=O)c2ccc(OCCOC)nc2)no1 |
| InChI | InChI=1S/C17H22N4O4/c1-3-14-19-16(20-25-14)13-5-4-8-21(13)17(22)12-6-7-15(18-11-12)24-10-9-23-2/h6-7,11,13H,3-5,8-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | ZHBZBPJJOBKDRC-ZDUSSCGKSA-N |
| XLogP | 2.03 |
| TPSA | 90.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|