C17H22N4O4 — CID 91920672
[2-[5-(2-methoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-pyridin-4-ylmethanone (PubChem CID 91920672) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is [2-[5-(2-methoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [2-[5-(2-methoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 91920672 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | [2-[5-(2-methoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-pyridin-4-ylmethanone |
| SMILES | COCCOCc1nc(C2CCCCN2C(=O)c2ccncc2)no1 |
| InChI | InChI=1S/C17H22N4O4/c1-23-10-11-24-12-15-19-16(20-25-15)14-4-2-3-9-21(14)17(22)13-5-7-18-8-6-13/h5-8,14H,2-4,9-12H2,1H3 |
| InChIKey | PCGRQBVSIVQUAG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 90.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|