C20H30N2O5 — CID 95783977
tert-butyl (3S)-3-[methyl-[2-(2-phenoxyethoxy)acetyl]amino]pyrrolidine-1-carboxylate (PubChem CID 95783977) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is tert-butyl (3S)-3-[methyl-[2-(2-phenoxyethoxy)acetyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[methyl-[2-(2-phenoxyethoxy)acetyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 95783977 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | tert-butyl (3S)-3-[methyl-[2-(2-phenoxyethoxy)acetyl]amino]pyrrolidine-1-carboxylate |
| SMILES | CN(C(=O)COCCOc1ccccc1)[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H30N2O5/c1-20(2,3)27-19(24)22-11-10-16(14-22)21(4)18(23)15-25-12-13-26-17-8-6-5-7-9-17/h5-9,16H,10-15H2,1-4H3/t16-/m0/s1 |
| InChIKey | YQCXARYRPVHSFQ-INIZCTEOSA-N |
| XLogP | 2.55 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|