C19H28FNO4 — CID 95784551
N-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-2-(2-fluorophenoxy)acetamide (PubChem CID 95784551) has the molecular formula C19H28FNO4 and a molecular weight of 353.43 g/mol. Its IUPAC name is N-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-2-(2-fluorophenoxy)acetamide.
| Compound Name | N-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-2-(2-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 95784551 |
| Molecular Formula | C19H28FNO4 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-2-(2-fluorophenoxy)acetamide |
| SMILES | CCC[C@@](C)(CCCNC(=O)COc1ccccc1F)C1OCCO1 |
| InChI | InChI=1S/C19H28FNO4/c1-3-9-19(2,18-23-12-13-24-18)10-6-11-21-17(22)14-25-16-8-5-4-7-15(16)20/h4-5,7-8,18H,3,6,9-14H2,1-2H3,(H,21,22)/t19-/m0/s1 |
| InChIKey | LVPJKRMKGAATEO-IBGZPJMESA-N |
| XLogP | 3.28 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|