C13H20FN2O2+ — CID 2330207
3-[[2-(2-fluorophenoxy)acetyl]amino]propyl-dimethylazanium (PubChem CID 2330207) has the molecular formula C13H20FN2O2+ and a molecular weight of 255.31 g/mol. Its IUPAC name is 3-[[2-(2-fluorophenoxy)acetyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[2-(2-fluorophenoxy)acetyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 2330207 |
| Molecular Formula | C13H20FN2O2+ |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 3-[[2-(2-fluorophenoxy)acetyl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCNC(=O)COc1ccccc1F |
| InChI | InChI=1S/C13H19FN2O2/c1-16(2)9-5-8-15-13(17)10-18-12-7-4-3-6-11(12)14/h3-4,6-7H,5,8-10H2,1-2H3,(H,15,17)/p+1 |
| InChIKey | QNORJHLBIGWBJX-UHFFFAOYSA-O |
| XLogP | -0.14 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|