C17H17F2NO5S2 — CID 95785171
methyl 3-[2-[(R)-benzylsulfinyl]ethylsulfamoyl]-2,6-difluorobenzoate (PubChem CID 95785171) has the molecular formula C17H17F2NO5S2 and a molecular weight of 417.46 g/mol. Its IUPAC name is methyl 3-[2-[(R)-benzylsulfinyl]ethylsulfamoyl]-2,6-difluorobenzoate.
| Compound Name | methyl 3-[2-[(R)-benzylsulfinyl]ethylsulfamoyl]-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 95785171 |
| Molecular Formula | C17H17F2NO5S2 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | methyl 3-[2-[(R)-benzylsulfinyl]ethylsulfamoyl]-2,6-difluorobenzoate |
| SMILES | COC(=O)c1c(F)ccc(S(=O)(=O)NCC[S@](=O)Cc2ccccc2)c1F |
| InChI | InChI=1S/C17H17F2NO5S2/c1-25-17(21)15-13(18)7-8-14(16(15)19)27(23,24)20-9-10-26(22)11-12-5-3-2-4-6-12/h2-8,20H,9-11H2,1H3/t26-/m0/s1 |
| InChIKey | LKNHTZNBUIMVLG-SANMLTNESA-N |
| XLogP | 1.98 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |