C16H30N4O4 — CID 95786399
methyl (3R)-3-[4-[2-(tert-butylcarbamoylamino)-2-oxoethyl]piperazin-1-yl]butanoate (PubChem CID 95786399) has the molecular formula C16H30N4O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is methyl (3R)-3-[4-[2-(tert-butylcarbamoylamino)-2-oxoethyl]piperazin-1-yl]butanoate.
| Compound Name | methyl (3R)-3-[4-[2-(tert-butylcarbamoylamino)-2-oxoethyl]piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 95786399 |
| Molecular Formula | C16H30N4O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | methyl (3R)-3-[4-[2-(tert-butylcarbamoylamino)-2-oxoethyl]piperazin-1-yl]butanoate |
| SMILES | COC(=O)C[C@@H](C)N1CCN(CC(=O)NC(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30N4O4/c1-12(10-14(22)24-5)20-8-6-19(7-9-20)11-13(21)17-15(23)18-16(2,3)4/h12H,6-11H2,1-5H3,(H2,17,18,21,23)/t12-/m1/s1 |
| InChIKey | OLDITNHWRYBQBU-GFCCVEGCSA-N |
| XLogP | 0.18 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |