C18H22N2O3 — CID 95788640
2-(3-acetylphenoxy)-N-[(R)-cyano(cyclohexyl)methyl]acetamide (PubChem CID 95788640) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-N-[(R)-cyano(cyclohexyl)methyl]acetamide.
| Compound Name | 2-(3-acetylphenoxy)-N-[(R)-cyano(cyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 95788640 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-(3-acetylphenoxy)-N-[(R)-cyano(cyclohexyl)methyl]acetamide |
| SMILES | CC(=O)c1cccc(OCC(=O)N[C@@H](C#N)C2CCCCC2)c1 |
| InChI | InChI=1S/C18H22N2O3/c1-13(21)15-8-5-9-16(10-15)23-12-18(22)20-17(11-19)14-6-3-2-4-7-14/h5,8-10,14,17H,2-4,6-7,12H2,1H3,(H,20,22)/t17-/m0/s1 |
| InChIKey | GIVUNFRLVDBPMF-KRWDZBQOSA-N |
| XLogP | 2.86 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |