C22H28FN5O — CID 95788899
(2R)-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-methyl-4-(6-methyl-2-pyridinyl)piperazine-1-carboxamide (PubChem CID 95788899) has the molecular formula C22H28FN5O and a molecular weight of 397.50 g/mol. Its IUPAC name is (2R)-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-methyl-4-(6-methyl-2-pyridinyl)piperazine-1-carboxamide.
| Compound Name | (2R)-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-methyl-4-(6-methyl-2-pyridinyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 95788899 |
| Molecular Formula | C22H28FN5O |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | (2R)-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-methyl-4-(6-methyl-2-pyridinyl)piperazine-1-carboxamide |
| SMILES | Cc1cccc(N2CCN(C(=O)Nc3ccc(N4CCCC4)c(F)c3)[C@H](C)C2)n1 |
| InChI | InChI=1S/C22H28FN5O/c1-16-6-5-7-21(24-16)27-12-13-28(17(2)15-27)22(29)25-18-8-9-20(19(23)14-18)26-10-3-4-11-26/h5-9,14,17H,3-4,10-13,15H2,1-2H3,(H,25,29)/t17-/m1/s1 |
| InChIKey | UZKVPVPEPSNOAG-QGZVFWFLSA-N |
| XLogP | 3.87 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|