C18H21N3O2 — CID 86785861
(3-hydroxyphenyl)-[2-methyl-4-(6-methyl-2-pyridinyl)piperazin-1-yl]methanone (PubChem CID 86785861) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is (3-hydroxyphenyl)-[2-methyl-4-(6-methyl-2-pyridinyl)piperazin-1-yl]methanone.
| Compound Name | (3-hydroxyphenyl)-[2-methyl-4-(6-methyl-2-pyridinyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 86785861 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (3-hydroxyphenyl)-[2-methyl-4-(6-methyl-2-pyridinyl)piperazin-1-yl]methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)c3cccc(O)c3)C(C)C2)n1 |
| InChI | InChI=1S/C18H21N3O2/c1-13-5-3-8-17(19-13)20-9-10-21(14(2)12-20)18(23)15-6-4-7-16(22)11-15/h3-8,11,14,22H,9-10,12H2,1-2H3 |
| InChIKey | CPAGBCNXKQYXRW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |