C16H17N5O2S — CID 95791899
N-[(2R)-1-(5-oxo-4-phenyltetrazol-1-yl)butan-2-yl]thiophene-2-carboxamide (PubChem CID 95791899) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-[(2R)-1-(5-oxo-4-phenyltetrazol-1-yl)butan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[(2R)-1-(5-oxo-4-phenyltetrazol-1-yl)butan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 95791899 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[(2R)-1-(5-oxo-4-phenyltetrazol-1-yl)butan-2-yl]thiophene-2-carboxamide |
| SMILES | CC[C@H](Cn1nnn(-c2ccccc2)c1=O)NC(=O)c1cccs1 |
| InChI | InChI=1S/C16H17N5O2S/c1-2-12(17-15(22)14-9-6-10-24-14)11-20-16(23)21(19-18-20)13-7-4-3-5-8-13/h3-10,12H,2,11H2,1H3,(H,17,22)/t12-/m1/s1 |
| InChIKey | RCVXDUGICPMYLD-GFCCVEGCSA-N |
| XLogP | 1.70 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |