C20H19NO6 — CID 95792067
ethyl (3S)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]-3-quinolin-6-ylpropanoate (PubChem CID 95792067) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is ethyl (3S)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]-3-quinolin-6-ylpropanoate.
| Compound Name | ethyl (3S)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]-3-quinolin-6-ylpropanoate |
|---|---|
| PubChem CID | 95792067 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | ethyl (3S)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]-3-quinolin-6-ylpropanoate |
| SMILES | CCOC(=O)C[C@@H](c1ccc2ncccc2c1)c1oc(CO)cc(=O)c1O |
| InChI | InChI=1S/C20H19NO6/c1-2-26-18(24)10-15(20-19(25)17(23)9-14(11-22)27-20)12-5-6-16-13(8-12)4-3-7-21-16/h3-9,15,22,25H,2,10-11H2,1H3/t15-/m0/s1 |
| InChIKey | HZSHHQBSBIYTNK-HNNXBMFYSA-N |
| XLogP | 2.47 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |